C14H17N5O3S — CID 88931966
N-[2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]-methylamino]ethyl]propanamide (PubChem CID 88931966) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is N-[2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]-methylamino]ethyl]propanamide.
| Compound Name | N-[2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]-methylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 88931966 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]-methylamino]ethyl]propanamide |
| SMILES | CCC(=O)NCCN(C)c1nccc(/C=C2\SC(=O)NC2=O)n1 |
| InChI | InChI=1S/C14H17N5O3S/c1-3-11(20)15-6-7-19(2)13-16-5-4-9(17-13)8-10-12(21)18-14(22)23-10/h4-5,8H,3,6-7H2,1-2H3,(H,15,20)(H,18,21,22)/b10-8- |
| InChIKey | LOKVLWKTSFLHLX-NTMALXAHSA-N |
| XLogP | 0.76 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|