C17H33N3 — CID 88932150
(2E,4E,6E)-4-[(dimethylamino)methyl]-6-ethylidene-N,N,N',N',5-pentamethylhepta-2,4-diene-1,7-diamine (PubChem CID 88932150) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is (2E,4E,6E)-4-[(dimethylamino)methyl]-6-ethylidene-N,N,N',N',5-pentamethylhepta-2,4-diene-1,7-diamine.
| Compound Name | (2E,4E,6E)-4-[(dimethylamino)methyl]-6-ethylidene-N,N,N',N',5-pentamethylhepta-2,4-diene-1,7-diamine |
|---|---|
| PubChem CID | 88932150 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | (2E,4E,6E)-4-[(dimethylamino)methyl]-6-ethylidene-N,N,N',N',5-pentamethylhepta-2,4-diene-1,7-diamine |
| SMILES | C/C=C(CN(C)C)\C(C)=C(/C=C/CN(C)C)CN(C)C |
| InChI | InChI=1S/C17H33N3/c1-9-16(13-19(5)6)15(2)17(14-20(7)8)11-10-12-18(3)4/h9-11H,12-14H2,1-8H3/b11-10+,16-9-,17-15+ |
| InChIKey | UIZRFVGEGLEQLM-XWIDQBLFSA-N |
| XLogP | 2.49 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|