C12H13F3O — CID 88932310
(2E,4Z)-1-cyclopropylidene-2-[(E)-3,3,3-trifluoroprop-1-enyl]hexa-2,4-dien-1-ol (PubChem CID 88932310) has the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. Its IUPAC name is (2E,4Z)-1-cyclopropylidene-2-[(E)-3,3,3-trifluoroprop-1-enyl]hexa-2,4-dien-1-ol.
| Compound Name | (2E,4Z)-1-cyclopropylidene-2-[(E)-3,3,3-trifluoroprop-1-enyl]hexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 88932310 |
| Molecular Formula | C12H13F3O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (2E,4Z)-1-cyclopropylidene-2-[(E)-3,3,3-trifluoroprop-1-enyl]hexa-2,4-dien-1-ol |
| SMILES | C/C=C\C=C(/C=C/C(F)(F)F)C(O)=C1CC1 |
| InChI | InChI=1S/C12H13F3O/c1-2-3-4-9(7-8-12(13,14)15)11(16)10-5-6-10/h2-4,7-8,16H,5-6H2,1H3/b3-2-,8-7+,9-4+ |
| InChIKey | PHLBYHPSXXASCV-IKWCNARPSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|