C17H26O — CID 88932394
(3R)-3-[(3E,5Z)-4,7-dimethylocta-3,5-dien-3-yl]-4-methylcyclohexa-1,5-dien-1-ol (PubChem CID 88932394) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (3R)-3-[(3E,5Z)-4,7-dimethylocta-3,5-dien-3-yl]-4-methylcyclohexa-1,5-dien-1-ol.
| Compound Name | (3R)-3-[(3E,5Z)-4,7-dimethylocta-3,5-dien-3-yl]-4-methylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 88932394 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (3R)-3-[(3E,5Z)-4,7-dimethylocta-3,5-dien-3-yl]-4-methylcyclohexa-1,5-dien-1-ol |
| SMILES | CC/C(=C(C)\C=C/C(C)C)[C@H]1C=C(O)C=CC1C |
| InChI | InChI=1S/C17H26O/c1-6-16(13(4)8-7-12(2)3)17-11-15(18)10-9-14(17)5/h7-12,14,17-18H,6H2,1-5H3/b8-7-,16-13+/t14?,17-/m0/s1 |
| InChIKey | XROMHDYPDIPTIR-SBUDRCGVSA-N |
| XLogP | 5.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|