About carbonodithioic S,S-acid;5,8-dimethylquinoxaline
carbonodithioic S,S-acid;5,8-dimethylquinoxaline (PubChem CID 88932901) has the molecular formula C11H12N2OS2
and a molecular weight of 252.36 g/mol. Its IUPAC name is carbonodithioic S,S-acid;5,8-dimethylquinoxaline.
Molecular Properties
| Compound Name | carbonodithioic S,S-acid;5,8-dimethylquinoxaline |
| PubChem CID | 88932901 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | carbonodithioic S,S-acid;5,8-dimethylquinoxaline |
| SMILES | Cc1ccc(C)c2nccnc12.O=C(S)S |
| InChI | InChI=1S/C10H10N2.CH2OS2/c1-7-3-4-8(2)10-9(7)11-5-6-12-10;2-1(3)4/h3-6H,1-2H3;(H2,2,3,4) |
| InChIKey | MHCZHVWOOCGUIY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbonodithioic S,S-acid;5,8-dimethylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonodithioic S,S-acid;5,8-dimethylquinoxaline?
The IUPAC name of carbonodithioic S,S-acid;5,8-dimethylquinoxaline (CID 88932901) is carbonodithioic S,S-acid;5,8-dimethylquinoxaline.
What is the SMILES notation for carbonodithioic S,S-acid;5,8-dimethylquinoxaline?
The canonical SMILES for carbonodithioic S,S-acid;5,8-dimethylquinoxaline is Cc1ccc(C)c2nccnc12.O=C(S)S.
What is the InChIKey of carbonodithioic S,S-acid;5,8-dimethylquinoxaline?
The InChIKey is MHCZHVWOOCGUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.CH2OS2/c1-7-3-4-8(2)10-9(7)11-5-6-12-10;2-1(3)4/h3-6H,1-2H3;(H2,2,3,4).
What are the key properties of carbonodithioic S,S-acid;5,8-dimethylquinoxaline?
carbonodithioic S,S-acid;5,8-dimethylquinoxaline has a molecular weight of 252.36 g/mol, XLogP of 3.21, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonodithioic S,S-acid;5,8-dimethylquinoxaline is sourced from PubChem (CID 88932901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).