C20H36INO3 — CID 88933420
N-[(1E,3S,4S,5E)-7-butoxy-1-iodo-3,5-dimethylhepta-1,5-dien-4-yl]-7-hydroxyheptanamide (PubChem CID 88933420) has the molecular formula C20H36INO3 and a molecular weight of 465.42 g/mol. Its IUPAC name is N-[(1E,3S,4S,5E)-7-butoxy-1-iodo-3,5-dimethylhepta-1,5-dien-4-yl]-7-hydroxyheptanamide.
| Compound Name | N-[(1E,3S,4S,5E)-7-butoxy-1-iodo-3,5-dimethylhepta-1,5-dien-4-yl]-7-hydroxyheptanamide |
|---|---|
| PubChem CID | 88933420 |
| Molecular Formula | C20H36INO3 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[(1E,3S,4S,5E)-7-butoxy-1-iodo-3,5-dimethylhepta-1,5-dien-4-yl]-7-hydroxyheptanamide |
| SMILES | CCCCOC/C=C(\C)[C@@H](NC(=O)CCCCCCO)[C@@H](C)/C=C/I |
| InChI | InChI=1S/C20H36INO3/c1-4-5-15-25-16-12-18(3)20(17(2)11-13-21)22-19(24)10-8-6-7-9-14-23/h11-13,17,20,23H,4-10,14-16H2,1-3H3,(H,22,24)/b13-11+,18-12+/t17-,20-/m0/s1 |
| InChIKey | IIXKWSJAYVCFRG-LWAWTVAASA-N |
| XLogP | 4.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|