C21H38INO3 — CID 88933445
N-[(1E,3S,4S,5E)-7-butoxy-1-iodo-3,5-dimethylhepta-1,5-dien-4-yl]-7-hydroxy-N-methylheptanamide (PubChem CID 88933445) has the molecular formula C21H38INO3 and a molecular weight of 479.44 g/mol. Its IUPAC name is N-[(1E,3S,4S,5E)-7-butoxy-1-iodo-3,5-dimethylhepta-1,5-dien-4-yl]-7-hydroxy-N-methylheptanamide.
| Compound Name | N-[(1E,3S,4S,5E)-7-butoxy-1-iodo-3,5-dimethylhepta-1,5-dien-4-yl]-7-hydroxy-N-methylheptanamide |
|---|---|
| PubChem CID | 88933445 |
| Molecular Formula | C21H38INO3 |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | N-[(1E,3S,4S,5E)-7-butoxy-1-iodo-3,5-dimethylhepta-1,5-dien-4-yl]-7-hydroxy-N-methylheptanamide |
| SMILES | CCCCOC/C=C(\C)[C@H]([C@@H](C)/C=C/I)N(C)C(=O)CCCCCCO |
| InChI | InChI=1S/C21H38INO3/c1-5-6-16-26-17-13-19(3)21(18(2)12-14-22)23(4)20(25)11-9-7-8-10-15-24/h12-14,18,21,24H,5-11,15-17H2,1-4H3/b14-12+,19-13+/t18-,21-/m0/s1 |
| InChIKey | SHOVIFUIMRCGSC-ONLZWCALSA-N |
| XLogP | 5.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|