C30H16N2O15S2 — CID 88933476
2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)oxysulfonylphenoxy]phenyl]sulfonyloxy-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 88933476) has the molecular formula C30H16N2O15S2 and a molecular weight of 708.59 g/mol. Its IUPAC name is 2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)oxysulfonylphenoxy]phenyl]sulfonyloxy-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)oxysulfonylphenoxy]phenyl]sulfonyloxy-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 88933476 |
| Molecular Formula | C30H16N2O15S2 |
| Molecular Weight | 708.59 g/mol |
| Exact Mass | 708.00 |
| IUPAC Name | 2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)oxysulfonylphenoxy]phenyl]sulfonyloxy-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(OS(=O)(=O)c1ccc(Oc3ccc(S(=O)(=O)ON4C(=O)c5ccc(C(=O)O)cc5C4=O)cc3)cc1)C2=O |
| InChI | InChI=1S/C30H16N2O15S2/c33-25-21-11-1-15(29(37)38)13-23(21)27(35)31(25)46-48(41,42)19-7-3-17(4-8-19)45-18-5-9-20(10-6-18)49(43,44)47-32-26(34)22-12-2-16(30(39)40)14-24(22)28(32)36/h1-14H,(H,37,38)(H,39,40) |
| InChIKey | GFHAZLKURKQNBB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 245.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|