C27H13N3O16S2 — CID 88933485
1-O-(2-hydroxy-1,3,5,7-tetraoxo-3a,4-dihydrocyclopenta[f]isoindol-6-yl) 3-O-(6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl) benzene-1,3-disulfonate (PubChem CID 88933485) has the molecular formula C27H13N3O16S2 and a molecular weight of 699.54 g/mol. Its IUPAC name is 1-O-(2-hydroxy-1,3,5,7-tetraoxo-3a,4-dihydrocyclopenta[f]isoindol-6-yl) 3-O-(6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl) benzene-1,3-disulfonate.
| Compound Name | 1-O-(2-hydroxy-1,3,5,7-tetraoxo-3a,4-dihydrocyclopenta[f]isoindol-6-yl) 3-O-(6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl) benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 88933485 |
| Molecular Formula | C27H13N3O16S2 |
| Molecular Weight | 699.54 g/mol |
| Exact Mass | 698.97 |
| IUPAC Name | 1-O-(2-hydroxy-1,3,5,7-tetraoxo-3a,4-dihydrocyclopenta[f]isoindol-6-yl) 3-O-(6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl) benzene-1,3-disulfonate |
| SMILES | O=C1C2=C(CC3C(=O)N(O)C(=O)C3=C2)C(=O)C1OS(=O)(=O)c1cccc(S(=O)(=O)On2c(=O)c3cc4c(=O)n(O)c(=O)c4cc3c2=O)c1 |
| InChI | InChI=1S/C27H13N3O16S2/c31-19-11-5-13-14(23(34)28(39)22(13)33)6-12(11)20(32)21(19)45-47(41,42)9-2-1-3-10(4-9)48(43,44)46-30-26(37)17-7-15-16(8-18(17)27(30)38)25(36)29(40)24(15)35/h1-5,7-8,14,21,39-40H,6H2 |
| InChIKey | CHRIDSWSOORNMN-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 276.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.54 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|