C44H68N2 — CID 88933639
2-[(1Z,6Z,8E,10E)-4-[(8aR)-1,2,4a,5,6,8a-hexahydronaphthalen-2-yl]-9,10-dimethyl-2-(10-methyldodecyl)-4-azabicyclo[9.4.0]pentadeca-1,6,8,10,14-pentaen-6-yl]pent-4-en-1-amine (PubChem CID 88933639) has the molecular formula C44H68N2 and a molecular weight of 625.04 g/mol. Its IUPAC name is 2-[(1Z,6Z,8E,10E)-4-[(8aR)-1,2,4a,5,6,8a-hexahydronaphthalen-2-yl]-9,10-dimethyl-2-(10-methyldodecyl)-4-azabicyclo[9.4.0]pentadeca-1,6,8,10,14-pentaen-6-yl]pent-4-en-1-amine.
| Compound Name | 2-[(1Z,6Z,8E,10E)-4-[(8aR)-1,2,4a,5,6,8a-hexahydronaphthalen-2-yl]-9,10-dimethyl-2-(10-methyldodecyl)-4-azabicyclo[9.4.0]pentadeca-1,6,8,10,14-pentaen-6-yl]pent-4-en-1-amine |
|---|---|
| PubChem CID | 88933639 |
| Molecular Formula | C44H68N2 |
| Molecular Weight | 625.04 g/mol |
| Exact Mass | 624.54 |
| IUPAC Name | 2-[(1Z,6Z,8E,10E)-4-[(8aR)-1,2,4a,5,6,8a-hexahydronaphthalen-2-yl]-9,10-dimethyl-2-(10-methyldodecyl)-4-azabicyclo[9.4.0]pentadeca-1,6,8,10,14-pentaen-6-yl]pent-4-en-1-amine |
| SMILES | C=CCC(CN)/C1=C/C=C(C)/C(C)=C2\CCC=C\C2=C(/CCCCCCCCCC(C)CC)CN(C2C=CC3CCC=C[C@H]3C2)C1 |
| InChI | InChI=1S/C44H68N2/c1-6-19-39(31-45)40-27-26-35(4)36(5)43-24-17-18-25-44(43)41(23-14-12-10-8-9-11-13-20-34(3)7-2)33-46(32-40)42-29-28-37-21-15-16-22-38(37)30-42/h6,16,18,22,25-29,34,37-39,42H,1,7-15,17,19-21,23-24,30-33,45H2,2-5H3/b35-26+,40-27+,43-36+,44-41-/t34?,37?,38-,39?,42?/m0/s1 |
| InChIKey | IUTMRAYUGADFFC-PBYGUBMTSA-N |
| XLogP | 11.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.04 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|