C24H34O6 — CID 88933675
6-[(E)-3-[(4S,5R)-5-[(Z,5S)-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3,4-trimethylbenzoic acid (PubChem CID 88933675) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is 6-[(E)-3-[(4S,5R)-5-[(Z,5S)-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3,4-trimethylbenzoic acid.
| Compound Name | 6-[(E)-3-[(4S,5R)-5-[(Z,5S)-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3,4-trimethylbenzoic acid |
|---|---|
| PubChem CID | 88933675 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 6-[(E)-3-[(4S,5R)-5-[(Z,5S)-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3,4-trimethylbenzoic acid |
| SMILES | Cc1cc(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2C(O)/C=C\C[C@H](C)O)c(C(=O)O)c(C)c1C |
| InChI | InChI=1S/C24H34O6/c1-14-13-18(21(23(27)28)17(4)16(14)3)10-8-12-20-22(30-24(5,6)29-20)19(26)11-7-9-15(2)25/h7-8,10-11,13,15,19-20,22,25-26H,9,12H2,1-6H3,(H,27,28)/b10-8+,11-7-/t15-,19?,20-,22+/m0/s1 |
| InChIKey | LXQDAEOWDKJYQC-DGTUIVKQSA-N |
| XLogP | 3.92 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|