C26H32N2 — CID 88933904
(1Z,3Z)-5-[4-(4-methylcyclohex-2-en-1-yl)-2,3,7,8-tetrahydronaphthalen-1-yl]-1-(2H-pyrrol-5-yl)penta-1,3-dien-1-amine (PubChem CID 88933904) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is (1Z,3Z)-5-[4-(4-methylcyclohex-2-en-1-yl)-2,3,7,8-tetrahydronaphthalen-1-yl]-1-(2H-pyrrol-5-yl)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-5-[4-(4-methylcyclohex-2-en-1-yl)-2,3,7,8-tetrahydronaphthalen-1-yl]-1-(2H-pyrrol-5-yl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 88933904 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | (1Z,3Z)-5-[4-(4-methylcyclohex-2-en-1-yl)-2,3,7,8-tetrahydronaphthalen-1-yl]-1-(2H-pyrrol-5-yl)penta-1,3-dien-1-amine |
| SMILES | CC1C=CC(C2=C3C=CCCC3=C(C/C=C\C=C(/N)C3=NCC=C3)CC2)CC1 |
| InChI | InChI=1S/C26H32N2/c1-19-12-14-21(15-13-19)23-17-16-20(22-8-3-4-9-24(22)23)7-2-5-10-25(27)26-11-6-18-28-26/h2,4-6,9-12,14,19,21H,3,7-8,13,15-18,27H2,1H3/b5-2-,25-10- |
| InChIKey | BAGPWTGBGVZCAU-CQNIOYJISA-N |
| XLogP | 6.13 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|