C34H68N11O7P3 — CID 88934008
21-amino-3,12,15-tris(2-methylpropyl)-6,9,18-tris[2-(phosphanylamino)ethyl]-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone (PubChem CID 88934008) has the molecular formula C34H68N11O7P3 and a molecular weight of 835.91 g/mol. Its IUPAC name is 21-amino-3,12,15-tris(2-methylpropyl)-6,9,18-tris[2-(phosphanylamino)ethyl]-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone.
| Compound Name | 21-amino-3,12,15-tris(2-methylpropyl)-6,9,18-tris[2-(phosphanylamino)ethyl]-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone |
|---|---|
| PubChem CID | 88934008 |
| Molecular Formula | C34H68N11O7P3 |
| Molecular Weight | 835.91 g/mol |
| Exact Mass | 835.45 |
| IUPAC Name | 21-amino-3,12,15-tris(2-methylpropyl)-6,9,18-tris[2-(phosphanylamino)ethyl]-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone |
| SMILES | CC(C)CC1NC(=O)C(CCNP)NC(=O)C(CCNP)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CCNP)NC(=O)C(N)CCNC1=O |
| InChI | InChI=1S/C34H68N11O7P3/c1-18(2)15-25-29(47)36-11-7-21(35)28(46)40-22(8-12-37-53)31(49)44-27(17-20(5)6)34(52)45-26(16-19(3)4)33(51)42-23(9-13-38-54)30(48)41-24(10-14-39-55)32(50)43-25/h18-27,37-39H,7-17,35,53-55H2,1-6H3,(H,36,47)(H,40,46)(H,41,48)(H,42,51)(H,43,50)(H,44,49)(H,45,52) |
| InChIKey | HVEKJBFAYQRPGA-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 265.81 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.91 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|