C13H14O4 — CID 88934199
4-(4-methylcyclohexa-1,3-dien-1-yl)benzene-1,2,3,5-tetrol (PubChem CID 88934199) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-(4-methylcyclohexa-1,3-dien-1-yl)benzene-1,2,3,5-tetrol.
| Compound Name | 4-(4-methylcyclohexa-1,3-dien-1-yl)benzene-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 88934199 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-(4-methylcyclohexa-1,3-dien-1-yl)benzene-1,2,3,5-tetrol |
| SMILES | CC1=CC=C(c2c(O)cc(O)c(O)c2O)CC1 |
| InChI | InChI=1S/C13H14O4/c1-7-2-4-8(5-3-7)11-9(14)6-10(15)12(16)13(11)17/h2,4,6,14-17H,3,5H2,1H3 |
| InChIKey | LYSWJXIUDKOUKN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|