About 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene
4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene (PubChem CID 88934209) has the molecular formula C13H9F6NO
and a molecular weight of 309.21 g/mol. Its IUPAC name is 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene.
Molecular Properties
| Compound Name | 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene |
| PubChem CID | 88934209 |
| Molecular Formula | C13H9F6NO |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene |
| SMILES | [O-][N+]12CC=C(c3cc(C(F)(F)F)ccc3C(F)(F)F)C1C2 |
| InChI | InChI=1S/C13H9F6NO/c14-12(15,16)7-1-2-10(13(17,18)19)9(5-7)8-3-4-20(21)6-11(8)20/h1-3,5,11H,4,6H2 |
| InChIKey | XLAMVFGGYVLDBO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene?
The IUPAC name of 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene (CID 88934209) is 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene.
What is the SMILES notation for 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene?
The canonical SMILES for 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene is [O-][N+]12CC=C(c3cc(C(F)(F)F)ccc3C(F)(F)F)C1C2.
What is the InChIKey of 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene?
The InChIKey is XLAMVFGGYVLDBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F6NO/c14-12(15,16)7-1-2-10(13(17,18)19)9(5-7)8-3-4-20(21)6-11(8)20/h1-3,5,11H,4,6H2.
What are the key properties of 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene?
4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene has a molecular weight of 309.21 g/mol, XLogP of 3.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,5-bis(trifluoromethyl)phenyl]-1-oxido-1-azoniabicyclo[3.1.0]hex-3-ene is sourced from PubChem (CID 88934209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).