About 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde
6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde (PubChem CID 88934595) has the molecular formula C11H10ClN5O3
and a molecular weight of 295.69 g/mol. Its IUPAC name is 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde.
Molecular Properties
| Compound Name | 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde |
| PubChem CID | 88934595 |
| Molecular Formula | C11H10ClN5O3 |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde |
| SMILES | COc1ncc(-c2nc(N)c(Cl)c(C=O)n2)c(OC)n1 |
| InChI | InChI=1S/C11H10ClN5O3/c1-19-10-5(3-14-11(17-10)20-2)9-15-6(4-18)7(12)8(13)16-9/h3-4H,1-2H3,(H2,13,15,16) |
| InChIKey | WJDPZNUYWPYAQM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde?
The IUPAC name of 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde (CID 88934595) is 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde.
What is the SMILES notation for 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde?
The canonical SMILES for 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde is COc1ncc(-c2nc(N)c(Cl)c(C=O)n2)c(OC)n1.
What is the InChIKey of 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde?
The InChIKey is WJDPZNUYWPYAQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN5O3/c1-19-10-5(3-14-11(17-10)20-2)9-15-6(4-18)7(12)8(13)16-9/h3-4H,1-2H3,(H2,13,15,16).
What are the key properties of 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde?
6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde has a molecular weight of 295.69 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-chloro-2-(2,4-dimethoxypyrimidin-5-yl)pyrimidine-4-carbaldehyde is sourced from PubChem (CID 88934595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).