C32H40BN7O4S — CID 88934781
CID 88934781 (PubChem CID 88934781) has the molecular formula C32H40BN7O4S and a molecular weight of 629.60 g/mol.
| Compound Name | CID 88934781 |
|---|---|
| PubChem CID | 88934781 |
| Molecular Formula | C32H40BN7O4S |
| Molecular Weight | 629.60 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)N1CCC(c2cc(OC(C)C)c(Nc3nc(Nc4ccccc4S(=O)(=O)C(C)C)c4c(C)[nH]nc4n3)cc2C)CC1 |
| InChI | InChI=1S/C32H40BN7O4S/c1-18(2)44-26-16-23(22-11-13-40(14-12-22)28(41)17-33)20(5)15-25(26)35-32-36-30(29-21(6)38-39-31(29)37-32)34-24-9-7-8-10-27(24)45(42,43)19(3)4/h7-10,15-16,18-19,22H,11-14,17H2,1-6H3,(H3,34,35,36,37,38,39) |
| InChIKey | AMPPPYIABAYGFU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|