C12H14N2 — CID 88934841
2-isocyano-4,5,7-trimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 88934841) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-isocyano-4,5,7-trimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
| Compound Name | 2-isocyano-4,5,7-trimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 88934841 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-isocyano-4,5,7-trimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | [C-]#[N+]c1cc(C)c2c(n1)C(C)CC2C |
| InChI | InChI=1S/C12H14N2/c1-7-5-9(3)12-11(7)8(2)6-10(13-4)14-12/h6-7,9H,5H2,1-3H3 |
| InChIKey | RGJGCKQGMWKLJC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|