About N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide
N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide (PubChem CID 88935026) has the molecular formula C9H14FNO
and a molecular weight of 171.21 g/mol. Its IUPAC name is N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide.
Molecular Properties
| Compound Name | N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide |
| PubChem CID | 88935026 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide |
| SMILES | C/C=C(\C=C/CF)CNC(C)=O |
| InChI | InChI=1S/C9H14FNO/c1-3-9(5-4-6-10)7-11-8(2)12/h3-5H,6-7H2,1-2H3,(H,11,12)/b5-4-,9-3+ |
| InChIKey | AWNGWDYPHPDNEO-SMPMWSNWSA-N |
| XLogP | 1.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide?
The IUPAC name of N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide (CID 88935026) is N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide.
What is the SMILES notation for N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide?
The canonical SMILES for N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide is C/C=C(\C=C/CF)CNC(C)=O.
What is the InChIKey of N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide?
The InChIKey is AWNGWDYPHPDNEO-SMPMWSNWSA-N. The full InChI is InChI=1S/C9H14FNO/c1-3-9(5-4-6-10)7-11-8(2)12/h3-5H,6-7H2,1-2H3,(H,11,12)/b5-4-,9-3+.
What are the key properties of N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide?
N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide has a molecular weight of 171.21 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z,2E)-2-ethylidene-5-fluoropent-3-enyl]acetamide is sourced from PubChem (CID 88935026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).