About 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol
5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol (PubChem CID 88935630) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol.
Molecular Properties
| Compound Name | 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol |
| PubChem CID | 88935630 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol |
| SMILES | C=CC1=C(S)CCNC1 |
| InChI | InChI=1S/C7H11NS/c1-2-6-5-8-4-3-7(6)9/h2,8-9H,1,3-5H2 |
| InChIKey | HTZWHDYTUSPLCL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol?
The IUPAC name of 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol (CID 88935630) is 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol.
What is the SMILES notation for 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol?
The canonical SMILES for 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol is C=CC1=C(S)CCNC1.
What is the InChIKey of 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol?
The InChIKey is HTZWHDYTUSPLCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS/c1-2-6-5-8-4-3-7(6)9/h2,8-9H,1,3-5H2.
What are the key properties of 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol?
5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol has a molecular weight of 141.24 g/mol, XLogP of 1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-1,2,3,6-tetrahydropyridine-4-thiol is sourced from PubChem (CID 88935630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).