C10H15ClN6O2S — CID 88935776
(NE)-N-[5-amino-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3-diazinan-2-ylidene]nitramide (PubChem CID 88935776) has the molecular formula C10H15ClN6O2S and a molecular weight of 318.79 g/mol. Its IUPAC name is (NE)-N-[5-amino-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3-diazinan-2-ylidene]nitramide.
| Compound Name | (NE)-N-[5-amino-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3-diazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 88935776 |
| Molecular Formula | C10H15ClN6O2S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (NE)-N-[5-amino-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3-diazinan-2-ylidene]nitramide |
| SMILES | CN1CC(C)(N)CN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-] |
| InChI | InChI=1S/C10H15ClN6O2S/c1-10(12)5-15(2)9(14-17(18)19)16(6-10)4-7-3-13-8(11)20-7/h3H,4-6,12H2,1-2H3/b14-9+ |
| InChIKey | UJHHOVRKQFHIIP-NTEUORMPSA-N |
| XLogP | 0.81 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|