C11H12O3 — CID 88936009
(4-formyl-2,3-dimethylphenyl) acetate (PubChem CID 88936009) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (4-formyl-2,3-dimethylphenyl) acetate.
| Compound Name | (4-formyl-2,3-dimethylphenyl) acetate |
|---|---|
| PubChem CID | 88936009 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (4-formyl-2,3-dimethylphenyl) acetate |
| SMILES | CC(=O)Oc1ccc(C=O)c(C)c1C |
| InChI | InChI=1S/C11H12O3/c1-7-8(2)11(14-9(3)13)5-4-10(7)6-12/h4-6H,1-3H3 |
| InChIKey | QNXVDCUKJFHDBA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|