C15H27F5O3 — CID 88936041
4-(butan-2-yloxymethyl)-2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropoxy)pentan-2-ol (PubChem CID 88936041) has the molecular formula C15H27F5O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is 4-(butan-2-yloxymethyl)-2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropoxy)pentan-2-ol.
| Compound Name | 4-(butan-2-yloxymethyl)-2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropoxy)pentan-2-ol |
|---|---|
| PubChem CID | 88936041 |
| Molecular Formula | C15H27F5O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-(butan-2-yloxymethyl)-2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropoxy)pentan-2-ol |
| SMILES | CCC(C)OCC(C)(COCC(F)(F)C(F)(F)F)CC(C)(C)O |
| InChI | InChI=1S/C15H27F5O3/c1-6-11(2)23-9-13(5,7-12(3,4)21)8-22-10-14(16,17)15(18,19)20/h11,21H,6-10H2,1-5H3 |
| InChIKey | CKQUGMMSJFFORV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|