C12H16F10O — CID 88936043
3-ethyl-1,1,1,2-tetrafluoro-4-(1,1,2,2,3,3-hexafluoropropoxy)-3,4-dimethylpentane (PubChem CID 88936043) has the molecular formula C12H16F10O and a molecular weight of 366.24 g/mol. Its IUPAC name is 3-ethyl-1,1,1,2-tetrafluoro-4-(1,1,2,2,3,3-hexafluoropropoxy)-3,4-dimethylpentane.
| Compound Name | 3-ethyl-1,1,1,2-tetrafluoro-4-(1,1,2,2,3,3-hexafluoropropoxy)-3,4-dimethylpentane |
|---|---|
| PubChem CID | 88936043 |
| Molecular Formula | C12H16F10O |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-ethyl-1,1,1,2-tetrafluoro-4-(1,1,2,2,3,3-hexafluoropropoxy)-3,4-dimethylpentane |
| SMILES | CCC(C)(C(F)C(F)(F)F)C(C)(C)OC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H16F10O/c1-5-9(4,6(13)11(18,19)20)8(2,3)23-12(21,22)10(16,17)7(14)15/h6-7H,5H2,1-4H3 |
| InChIKey | QODFPHJRTOYBGQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|