C24H31N3O5S2 — CID 88936125
N-[2-ethyl-4-oxo-4-[(3S,4S)-3-[(4-phenoxyphenyl)sulfonylamino]-4-sulfanylpyrrolidin-1-yl]butyl]acetamide (PubChem CID 88936125) has the molecular formula C24H31N3O5S2 and a molecular weight of 505.66 g/mol. Its IUPAC name is N-[2-ethyl-4-oxo-4-[(3S,4S)-3-[(4-phenoxyphenyl)sulfonylamino]-4-sulfanylpyrrolidin-1-yl]butyl]acetamide.
| Compound Name | N-[2-ethyl-4-oxo-4-[(3S,4S)-3-[(4-phenoxyphenyl)sulfonylamino]-4-sulfanylpyrrolidin-1-yl]butyl]acetamide |
|---|---|
| PubChem CID | 88936125 |
| Molecular Formula | C24H31N3O5S2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | N-[2-ethyl-4-oxo-4-[(3S,4S)-3-[(4-phenoxyphenyl)sulfonylamino]-4-sulfanylpyrrolidin-1-yl]butyl]acetamide |
| SMILES | CCC(CNC(C)=O)CC(=O)N1C[C@H](NS(=O)(=O)c2ccc(Oc3ccccc3)cc2)[C@@H](S)C1 |
| InChI | InChI=1S/C24H31N3O5S2/c1-3-18(14-25-17(2)28)13-24(29)27-15-22(23(33)16-27)26-34(30,31)21-11-9-20(10-12-21)32-19-7-5-4-6-8-19/h4-12,18,22-23,26,33H,3,13-16H2,1-2H3,(H,25,28)/t18?,22-,23-/m0/s1 |
| InChIKey | BCCLLQBXLMDIAP-BFLQJQPQSA-N |
| XLogP | 2.82 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|