C12H23F3O — CID 88936210
2,2,3,5,5-pentamethyl-4-(trifluoromethoxy)hexane (PubChem CID 88936210) has the molecular formula C12H23F3O and a molecular weight of 240.31 g/mol. Its IUPAC name is 2,2,3,5,5-pentamethyl-4-(trifluoromethoxy)hexane.
| Compound Name | 2,2,3,5,5-pentamethyl-4-(trifluoromethoxy)hexane |
|---|---|
| PubChem CID | 88936210 |
| Molecular Formula | C12H23F3O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2,2,3,5,5-pentamethyl-4-(trifluoromethoxy)hexane |
| SMILES | CC(C(OC(F)(F)F)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H23F3O/c1-8(10(2,3)4)9(11(5,6)7)16-12(13,14)15/h8-9H,1-7H3 |
| InChIKey | IBADIPYWFRGUAH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |