C20H37N3O4 — CID 88936917
1-oxobutan-2-yl 2-amino-2-[5-(butylcarbamoylamino)-1,3,3-trimethylcyclohexyl]acetate (PubChem CID 88936917) has the molecular formula C20H37N3O4 and a molecular weight of 383.53 g/mol. Its IUPAC name is 1-oxobutan-2-yl 2-amino-2-[5-(butylcarbamoylamino)-1,3,3-trimethylcyclohexyl]acetate.
| Compound Name | 1-oxobutan-2-yl 2-amino-2-[5-(butylcarbamoylamino)-1,3,3-trimethylcyclohexyl]acetate |
|---|---|
| PubChem CID | 88936917 |
| Molecular Formula | C20H37N3O4 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | 1-oxobutan-2-yl 2-amino-2-[5-(butylcarbamoylamino)-1,3,3-trimethylcyclohexyl]acetate |
| SMILES | CCCCNC(=O)NC1CC(C)(C)CC(C)(C(N)C(=O)OC(C=O)CC)C1 |
| InChI | InChI=1S/C20H37N3O4/c1-6-8-9-22-18(26)23-14-10-19(3,4)13-20(5,11-14)16(21)17(25)27-15(7-2)12-24/h12,14-16H,6-11,13,21H2,1-5H3,(H2,22,23,26) |
| InChIKey | HQXUSPLMVGOGGW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|