About [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate
[4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 8893713) has the molecular formula C17H9ClN2O3S
and a molecular weight of 356.79 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| PubChem CID | 8893713 |
| Molecular Formula | C17H9ClN2O3S |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc(-c2nnco2)cc1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C17H9ClN2O3S/c18-14-12-3-1-2-4-13(12)24-15(14)17(21)23-11-7-5-10(6-8-11)16-20-19-9-22-16/h1-9H |
| InChIKey | ZWFUKXGCXNFFHQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate?
The IUPAC name of [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate (CID 8893713) is [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
What is the SMILES notation for [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate?
The canonical SMILES for [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate is O=C(Oc1ccc(-c2nnco2)cc1)c1sc2ccccc2c1Cl.
What is the InChIKey of [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate?
The InChIKey is ZWFUKXGCXNFFHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClN2O3S/c18-14-12-3-1-2-4-13(12)24-15(14)17(21)23-11-7-5-10(6-8-11)16-20-19-9-22-16/h1-9H.
What are the key properties of [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate?
[4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate has a molecular weight of 356.79 g/mol, XLogP of 4.82, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 8893713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).