C7H4F5N3O4 — CID 88937737
1-methyl-4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylic acid (PubChem CID 88937737) has the molecular formula C7H4F5N3O4 and a molecular weight of 289.12 g/mol. Its IUPAC name is 1-methyl-4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylic acid.
| Compound Name | 1-methyl-4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 88937737 |
| Molecular Formula | C7H4F5N3O4 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 1-methyl-4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylic acid |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C7H4F5N3O4/c1-14-3(5(16)17)2(15(18)19)4(13-14)6(8,9)7(10,11)12/h1H3,(H,16,17) |
| InChIKey | BWKXILGIRKUFGJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|