C8H6F5N3O4 — CID 88937818
methyl 1-methyl-4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylate (PubChem CID 88937818) has the molecular formula C8H6F5N3O4 and a molecular weight of 303.14 g/mol. Its IUPAC name is methyl 1-methyl-4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylate.
| Compound Name | methyl 1-methyl-4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 88937818 |
| Molecular Formula | C8H6F5N3O4 |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | methyl 1-methyl-4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylate |
| SMILES | COC(=O)c1c([N+](=O)[O-])c(C(F)(F)C(F)(F)F)nn1C |
| InChI | InChI=1S/C8H6F5N3O4/c1-15-4(6(17)20-2)3(16(18)19)5(14-15)7(9,10)8(11,12)13/h1-2H3 |
| InChIKey | JWIBANNWCGXZQQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|