C18H18N6O — CID 88937848
N-(cyanomethyl)-1-(7H-pyrrolo[2,3-h][2,6]naphthyridin-1-yl)piperidine-3-carboxamide (PubChem CID 88937848) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is N-(cyanomethyl)-1-(7H-pyrrolo[2,3-h][2,6]naphthyridin-1-yl)piperidine-3-carboxamide.
| Compound Name | N-(cyanomethyl)-1-(7H-pyrrolo[2,3-h][2,6]naphthyridin-1-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 88937848 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-(cyanomethyl)-1-(7H-pyrrolo[2,3-h][2,6]naphthyridin-1-yl)piperidine-3-carboxamide |
| SMILES | N#CCNC(=O)C1CCCN(c2nccc3cnc4[nH]ccc4c23)C1 |
| InChI | InChI=1S/C18H18N6O/c19-5-8-22-18(25)13-2-1-9-24(11-13)17-15-12(3-6-21-17)10-23-16-14(15)4-7-20-16/h3-4,6-7,10,13H,1-2,8-9,11H2,(H,20,23)(H,22,25) |
| InChIKey | DIAYGJQALHNTFY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|