C24H41NO8 — CID 88937975
(2S)-2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3,3-dimethyl-2-(pent-4-enoyloxymethyl)butanoic acid (PubChem CID 88937975) has the molecular formula C24H41NO8 and a molecular weight of 471.59 g/mol. Its IUPAC name is (2S)-2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3,3-dimethyl-2-(pent-4-enoyloxymethyl)butanoic acid.
| Compound Name | (2S)-2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3,3-dimethyl-2-(pent-4-enoyloxymethyl)butanoic acid |
|---|---|
| PubChem CID | 88937975 |
| Molecular Formula | C24H41NO8 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | (2S)-2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3,3-dimethyl-2-(pent-4-enoyloxymethyl)butanoic acid |
| SMILES | C=CCCC(=O)OC[C@@](C(=O)O)(N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H41NO8/c1-11-12-13-17(26)31-16-24(20(29)30,21(2,3)4)25(14-18(27)32-22(5,6)7)15-19(28)33-23(8,9)10/h11H,1,12-16H2,2-10H3,(H,29,30)/t24-/m0/s1 |
| InChIKey | IHXGTKBTGKGXRB-DEOSSOPVSA-N |
| XLogP | 3.35 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|