About 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid
2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid (PubChem CID 88938000) has the molecular formula C19H35NO7
and a molecular weight of 389.49 g/mol. Its IUPAC name is 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid |
| PubChem CID | 88938000 |
| Molecular Formula | C19H35NO7 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)OC(=O)CN(CC(=O)OC(C)(C)C)C(C(=O)O)C(O)C(C)(C)C |
| InChI | InChI=1S/C19H35NO7/c1-17(2,3)15(23)14(16(24)25)20(10-12(21)26-18(4,5)6)11-13(22)27-19(7,8)9/h14-15,23H,10-11H2,1-9H3,(H,24,25) |
| InChIKey | GFTFYPLGVZGAHW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid?
The IUPAC name of 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid (CID 88938000) is 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid.
What is the SMILES notation for 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid?
The canonical SMILES for 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid is CC(C)(C)OC(=O)CN(CC(=O)OC(C)(C)C)C(C(=O)O)C(O)C(C)(C)C.
What is the InChIKey of 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid?
The InChIKey is GFTFYPLGVZGAHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35NO7/c1-17(2,3)15(23)14(16(24)25)20(10-12(21)26-18(4,5)6)11-13(22)27-19(7,8)9/h14-15,23H,10-11H2,1-9H3,(H,24,25).
What are the key properties of 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid?
2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid has a molecular weight of 389.49 g/mol, XLogP of 1.83, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-hydroxy-4,4-dimethylpentanoic acid is sourced from PubChem (CID 88938000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).