C16H24N2O2 — CID 88938119
(4Z)-4-[[[(1Z,3Z)-2-hydroxy-3-(methyliminomethyl)penta-1,3-dienyl]-methylazaniumylidene]methyl]-2-methylhexa-2,4-dien-3-olate (PubChem CID 88938119) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (4Z)-4-[[[(1Z,3Z)-2-hydroxy-3-(methyliminomethyl)penta-1,3-dienyl]-methylazaniumylidene]methyl]-2-methylhexa-2,4-dien-3-olate.
| Compound Name | (4Z)-4-[[[(1Z,3Z)-2-hydroxy-3-(methyliminomethyl)penta-1,3-dienyl]-methylazaniumylidene]methyl]-2-methylhexa-2,4-dien-3-olate |
|---|---|
| PubChem CID | 88938119 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (4Z)-4-[[[(1Z,3Z)-2-hydroxy-3-(methyliminomethyl)penta-1,3-dienyl]-methylazaniumylidene]methyl]-2-methylhexa-2,4-dien-3-olate |
| SMILES | C/C=C(/C=[N+](C)/C=C(O)/C(=C\C)/C=N/C)C([O-])=C(C)C |
| InChI | InChI=1S/C16H24N2O2/c1-7-13(9-17-5)15(19)11-18(6)10-14(8-2)16(20)12(3)4/h7-11H,1-6H3,(H-,19,20)/b13-7-,14-8-,15-11-,17-9+,18-10+ |
| InChIKey | USESHQYSEVGOKR-PUNRKOOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|