C61H57N — CID 88938174
10-[3-(7-tert-butyl-3-methylpyren-1-yl)phenyl]-N,N-bis(4-tert-butylphenyl)anthracen-9-amine (PubChem CID 88938174) has the molecular formula C61H57N and a molecular weight of 804.13 g/mol. Its IUPAC name is 10-[3-(7-tert-butyl-3-methylpyren-1-yl)phenyl]-N,N-bis(4-tert-butylphenyl)anthracen-9-amine.
| Compound Name | 10-[3-(7-tert-butyl-3-methylpyren-1-yl)phenyl]-N,N-bis(4-tert-butylphenyl)anthracen-9-amine |
|---|---|
| PubChem CID | 88938174 |
| Molecular Formula | C61H57N |
| Molecular Weight | 804.13 g/mol |
| Exact Mass | 803.45 |
| IUPAC Name | 10-[3-(7-tert-butyl-3-methylpyren-1-yl)phenyl]-N,N-bis(4-tert-butylphenyl)anthracen-9-amine |
| SMILES | Cc1cc(-c2cccc(-c3c4ccccc4c(N(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)c4ccccc34)c2)c2ccc3cc(C(C)(C)C)cc4ccc1c2c43 |
| InChI | InChI=1S/C61H57N/c1-38-34-54(51-33-23-42-37-45(61(8,9)10)36-41-22-32-48(38)57(51)55(41)42)39-16-15-17-40(35-39)56-49-18-11-13-20-52(49)58(53-21-14-12-19-50(53)56)62(46-28-24-43(25-29-46)59(2,3)4)47-30-26-44(27-31-47)60(5,6)7/h11-37H,1-10H3 |
| InChIKey | KOFGXICJJZAPMS-UHFFFAOYSA-N |
| XLogP | 17.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.13 |
| LogP ≤ 5 | 17.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|