C17H27FN3O7PS — CID 88938343
S-[2-[dimethylamino-[[(2R,4S,5R)-4-fluoro-3-hydroxy-3-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] ethanethioate (PubChem CID 88938343) has the molecular formula C17H27FN3O7PS and a molecular weight of 467.46 g/mol. Its IUPAC name is S-[2-[dimethylamino-[[(2R,4S,5R)-4-fluoro-3-hydroxy-3-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] ethanethioate.
| Compound Name | S-[2-[dimethylamino-[[(2R,4S,5R)-4-fluoro-3-hydroxy-3-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] ethanethioate |
|---|---|
| PubChem CID | 88938343 |
| Molecular Formula | C17H27FN3O7PS |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | S-[2-[dimethylamino-[[(2R,4S,5R)-4-fluoro-3-hydroxy-3-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] ethanethioate |
| SMILES | C=C1NC(=O)C=CN1[C@@H]1O[C@H](COP(=O)(OCCSC(C)=O)N(C)C)C(C)(O)[C@@H]1F |
| InChI | InChI=1S/C17H27FN3O7PS/c1-11-19-14(23)6-7-21(11)16-15(18)17(3,24)13(28-16)10-27-29(25,20(4)5)26-8-9-30-12(2)22/h6-7,13,15-16,24H,1,8-10H2,2-5H3,(H,19,23)/t13-,15-,16-,17?,29?/m1/s1 |
| InChIKey | SKUGTBRHHRBNLJ-WCRLRKQPSA-N |
| XLogP | 1.20 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|