C14H18N6O4 — CID 88938453
(2S)-2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]-N-(2-oxoethyl)butanamide (PubChem CID 88938453) has the molecular formula C14H18N6O4 and a molecular weight of 334.34 g/mol. Its IUPAC name is (2S)-2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]-N-(2-oxoethyl)butanamide.
| Compound Name | (2S)-2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]-N-(2-oxoethyl)butanamide |
|---|---|
| PubChem CID | 88938453 |
| Molecular Formula | C14H18N6O4 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2S)-2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]-N-(2-oxoethyl)butanamide |
| SMILES | CC[C@@H](C(=O)NCC=O)n1ccnc(NCc2nonc2C)c1=O |
| InChI | InChI=1S/C14H18N6O4/c1-3-11(13(22)16-5-7-21)20-6-4-15-12(14(20)23)17-8-10-9(2)18-24-19-10/h4,6-7,11H,3,5,8H2,1-2H3,(H,15,17)(H,16,22)/t11-/m0/s1 |
| InChIKey | CCIQWKILFZHFOW-NSHDSACASA-N |
| XLogP | -0.19 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|