C22H35N7O3 — CID 88938553
N-[3-[cyclohexyl(methyl)amino]-2-oxopropyl]-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanamide (PubChem CID 88938553) has the molecular formula C22H35N7O3 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]-2-oxopropyl]-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]-2-oxopropyl]-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanamide |
|---|---|
| PubChem CID | 88938553 |
| Molecular Formula | C22H35N7O3 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]-2-oxopropyl]-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanamide |
| SMILES | [H]/N=C(CNc1nccn(C(CC)C(=O)NCC(=O)CN(C)C2CCCCC2)c1=O)\C(C)=N\[H] |
| InChI | InChI=1S/C22H35N7O3/c1-4-19(29-11-10-25-20(22(29)32)26-13-18(24)15(2)23)21(31)27-12-17(30)14-28(3)16-8-6-5-7-9-16/h10-11,16,19,23-24H,4-9,12-14H2,1-3H3,(H,25,26)(H,27,31)/b23-15+,24-18- |
| InChIKey | ONCZBGJUAFLQHP-YPTSKYFGSA-N |
| XLogP | 1.62 |
| TPSA | 144.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|