C19H20N4O4 — CID 88938559
5-cyano-2-hydroxy-N,N-dimethyl-3-[[2-[[(2S)-3-methylbut-3-en-2-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzamide (PubChem CID 88938559) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 5-cyano-2-hydroxy-N,N-dimethyl-3-[[2-[[(2S)-3-methylbut-3-en-2-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzamide.
| Compound Name | 5-cyano-2-hydroxy-N,N-dimethyl-3-[[2-[[(2S)-3-methylbut-3-en-2-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzamide |
|---|---|
| PubChem CID | 88938559 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 5-cyano-2-hydroxy-N,N-dimethyl-3-[[2-[[(2S)-3-methylbut-3-en-2-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzamide |
| SMILES | C=C(C)[C@H](C)Nc1c(Nc2cc(C#N)cc(C(=O)N(C)C)c2O)c(=O)c1=O |
| InChI | InChI=1S/C19H20N4O4/c1-9(2)10(3)21-14-15(18(26)17(14)25)22-13-7-11(8-20)6-12(16(13)24)19(27)23(4)5/h6-7,10,21-22,24H,1H2,2-5H3/t10-/m0/s1 |
| InChIKey | JNGJKLUVFRLBRJ-JTQLQIEISA-N |
| XLogP | 1.68 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|