C23H32ClN3O3 — CID 88938790
7-chloro-N-[5-(3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecan-9-yl)pentyl]quinolin-4-amine (PubChem CID 88938790) has the molecular formula C23H32ClN3O3 and a molecular weight of 433.98 g/mol. Its IUPAC name is 7-chloro-N-[5-(3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecan-9-yl)pentyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[5-(3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecan-9-yl)pentyl]quinolin-4-amine |
|---|---|
| PubChem CID | 88938790 |
| Molecular Formula | C23H32ClN3O3 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 7-chloro-N-[5-(3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecan-9-yl)pentyl]quinolin-4-amine |
| SMILES | CC1(C)COC2(CCN(CCCCCNc3ccnc4cc(Cl)ccc34)CC2)OO1 |
| InChI | InChI=1S/C23H32ClN3O3/c1-22(2)17-28-23(30-29-22)9-14-27(15-10-23)13-5-3-4-11-25-20-8-12-26-21-16-18(24)6-7-19(20)21/h6-8,12,16H,3-5,9-11,13-15,17H2,1-2H3,(H,25,26) |
| InChIKey | QDIMTFYVQUWPTH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|