About 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione
5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione (PubChem CID 88939496) has the molecular formula C9H17N3O3
and a molecular weight of 215.25 g/mol. Its IUPAC name is 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione |
| PubChem CID | 88939496 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione |
| SMILES | CCCCNOC1C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C9H17N3O3/c1-4-5-6-10-15-8-7(13)11(2)9(14)12(8)3/h8,10H,4-6H2,1-3H3 |
| InChIKey | KJNDCDSKGKRFOE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione?
The IUPAC name of 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione (CID 88939496) is 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione.
What is the SMILES notation for 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione?
The canonical SMILES for 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione is CCCCNOC1C(=O)N(C)C(=O)N1C.
What is the InChIKey of 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione?
The InChIKey is KJNDCDSKGKRFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O3/c1-4-5-6-10-15-8-7(13)11(2)9(14)12(8)3/h8,10H,4-6H2,1-3H3.
What are the key properties of 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione?
5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione has a molecular weight of 215.25 g/mol, XLogP of 0.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(butylaminooxy)-1,3-dimethylimidazolidine-2,4-dione is sourced from PubChem (CID 88939496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).