C21H40N2 — CID 88939927
N-methyl-N-[[(10Z,13Z)-nonadeca-10,13-dienylidene]amino]methanamine (PubChem CID 88939927) has the molecular formula C21H40N2 and a molecular weight of 320.56 g/mol. Its IUPAC name is N-methyl-N-[[(10Z,13Z)-nonadeca-10,13-dienylidene]amino]methanamine.
| Compound Name | N-methyl-N-[[(10Z,13Z)-nonadeca-10,13-dienylidene]amino]methanamine |
|---|---|
| PubChem CID | 88939927 |
| Molecular Formula | C21H40N2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | N-methyl-N-[[(10Z,13Z)-nonadeca-10,13-dienylidene]amino]methanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC=NN(C)C |
| InChI | InChI=1S/C21H40N2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(2)3/h8-9,11-12,21H,4-7,10,13-20H2,1-3H3/b9-8-,12-11-,22-21? |
| InChIKey | OZOKLNKDTXUBCZ-HVDXYJLDSA-N |
| XLogP | 6.74 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|