C22H26N4O4 — CID 88939997
N,N-dimethyl-5-[[2-[[(3R,5Z,7Z)-4-methylidenenona-5,7-dien-3-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 88939997) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is N,N-dimethyl-5-[[2-[[(3R,5Z,7Z)-4-methylidenenona-5,7-dien-3-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N,N-dimethyl-5-[[2-[[(3R,5Z,7Z)-4-methylidenenona-5,7-dien-3-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 88939997 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N,N-dimethyl-5-[[2-[[(3R,5Z,7Z)-4-methylidenenona-5,7-dien-3-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | C=C(/C=C\C=C/C)[C@@H](CC)Nc1c(Nc2c[nH]cc(C(=O)N(C)C)c2=O)c(=O)c1=O |
| InChI | InChI=1S/C22H26N4O4/c1-6-8-9-10-13(3)15(7-2)24-17-18(21(29)20(17)28)25-16-12-23-11-14(19(16)27)22(30)26(4)5/h6,8-12,15,24-25H,3,7H2,1-2,4-5H3,(H,23,27)/b8-6-,10-9-/t15-/m1/s1 |
| InChIKey | PQAHTDFEHMSLCR-ZLNWWKIVSA-N |
| XLogP | 2.30 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|