C23H34OS — CID 88940326
9-[[2-methyl-2-[(2-methylpropan-2-yl)oxy]propyl]sulfanylmethyl]-1,2,8,8a,9,9a-hexahydroanthracene (PubChem CID 88940326) has the molecular formula C23H34OS and a molecular weight of 358.59 g/mol. Its IUPAC name is 9-[[2-methyl-2-[(2-methylpropan-2-yl)oxy]propyl]sulfanylmethyl]-1,2,8,8a,9,9a-hexahydroanthracene.
| Compound Name | 9-[[2-methyl-2-[(2-methylpropan-2-yl)oxy]propyl]sulfanylmethyl]-1,2,8,8a,9,9a-hexahydroanthracene |
|---|---|
| PubChem CID | 88940326 |
| Molecular Formula | C23H34OS |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 9-[[2-methyl-2-[(2-methylpropan-2-yl)oxy]propyl]sulfanylmethyl]-1,2,8,8a,9,9a-hexahydroanthracene |
| SMILES | CC(C)(C)OC(C)(C)CSCC1C2CC=CC=C2C=C2C=CCCC21 |
| InChI | InChI=1S/C23H34OS/c1-22(2,3)24-23(4,5)16-25-15-21-19-12-8-6-10-17(19)14-18-11-7-9-13-20(18)21/h6-8,10-11,14,19-21H,9,12-13,15-16H2,1-5H3 |
| InChIKey | PUXOGGVOKWTTAG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |