C22H32O2S — CID 88940332
2-methylbutan-2-yl 2-[(Z)-3-(3-ethyl-3,4,4a,5-tetrahydronaphthalen-2-yl)prop-2-enyl]sulfanylacetate (PubChem CID 88940332) has the molecular formula C22H32O2S and a molecular weight of 360.56 g/mol. Its IUPAC name is 2-methylbutan-2-yl 2-[(Z)-3-(3-ethyl-3,4,4a,5-tetrahydronaphthalen-2-yl)prop-2-enyl]sulfanylacetate.
| Compound Name | 2-methylbutan-2-yl 2-[(Z)-3-(3-ethyl-3,4,4a,5-tetrahydronaphthalen-2-yl)prop-2-enyl]sulfanylacetate |
|---|---|
| PubChem CID | 88940332 |
| Molecular Formula | C22H32O2S |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-methylbutan-2-yl 2-[(Z)-3-(3-ethyl-3,4,4a,5-tetrahydronaphthalen-2-yl)prop-2-enyl]sulfanylacetate |
| SMILES | CCC1CC2CC=CC=C2C=C1/C=C\CSCC(=O)OC(C)(C)CC |
| InChI | InChI=1S/C22H32O2S/c1-5-17-14-19-10-7-8-11-20(19)15-18(17)12-9-13-25-16-21(23)24-22(3,4)6-2/h7-9,11-12,15,17,19H,5-6,10,13-14,16H2,1-4H3/b12-9- |
| InChIKey | SHIMZWNLVLTWJS-XFXZXTDPSA-N |
| XLogP | 5.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|