C16H22S — CID 88940334
3-(3-ethenyl-1,2,8,8a-tetrahydronaphthalen-2-yl)-2-methylpropane-1-thiol (PubChem CID 88940334) has the molecular formula C16H22S and a molecular weight of 246.42 g/mol. Its IUPAC name is 3-(3-ethenyl-1,2,8,8a-tetrahydronaphthalen-2-yl)-2-methylpropane-1-thiol.
| Compound Name | 3-(3-ethenyl-1,2,8,8a-tetrahydronaphthalen-2-yl)-2-methylpropane-1-thiol |
|---|---|
| PubChem CID | 88940334 |
| Molecular Formula | C16H22S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-(3-ethenyl-1,2,8,8a-tetrahydronaphthalen-2-yl)-2-methylpropane-1-thiol |
| SMILES | C=CC1=CC2=CC=CCC2CC1CC(C)CS |
| InChI | InChI=1S/C16H22S/c1-3-13-9-14-6-4-5-7-15(14)10-16(13)8-12(2)11-17/h3-6,9,12,15-17H,1,7-8,10-11H2,2H3 |
| InChIKey | PFMMAHAIRZYFKU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|