C25H36O2S — CID 88940339
(1-ethylcyclopentyl) 2-[[6-[(2Z)-penta-2,4-dienyl]-3,4,4a,5,6,7-hexahydronaphthalen-2-yl]methylsulfanyl]acetate (PubChem CID 88940339) has the molecular formula C25H36O2S and a molecular weight of 400.63 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2-[[6-[(2Z)-penta-2,4-dienyl]-3,4,4a,5,6,7-hexahydronaphthalen-2-yl]methylsulfanyl]acetate.
| Compound Name | (1-ethylcyclopentyl) 2-[[6-[(2Z)-penta-2,4-dienyl]-3,4,4a,5,6,7-hexahydronaphthalen-2-yl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 88940339 |
| Molecular Formula | C25H36O2S |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | (1-ethylcyclopentyl) 2-[[6-[(2Z)-penta-2,4-dienyl]-3,4,4a,5,6,7-hexahydronaphthalen-2-yl]methylsulfanyl]acetate |
| SMILES | C=C/C=C\CC1CC=C2C=C(CSCC(=O)OC3(CC)CCCC3)CCC2C1 |
| InChI | InChI=1S/C25H36O2S/c1-3-5-6-9-20-10-12-23-17-21(11-13-22(23)16-20)18-28-19-24(26)27-25(4-2)14-7-8-15-25/h3,5-6,12,17,20,22H,1,4,7-11,13-16,18-19H2,2H3/b6-5- |
| InChIKey | XULUOBLEXPCVKV-WAYWQWQTSA-N |
| XLogP | 6.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|