C10H13FN2O4S — CID 88940610
5-[(2S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyl-2-sulfanylidenepyrimidin-4-one (PubChem CID 88940610) has the molecular formula C10H13FN2O4S and a molecular weight of 276.29 g/mol. Its IUPAC name is 5-[(2S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyl-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(2S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyl-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 88940610 |
| Molecular Formula | C10H13FN2O4S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 5-[(2S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methyl-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cn1cc([C@@H]2O[C@H](CO)C(O)C2F)c(=O)[nH]c1=S |
| InChI | InChI=1S/C10H13FN2O4S/c1-13-2-4(9(16)12-10(13)18)8-6(11)7(15)5(3-14)17-8/h2,5-8,14-15H,3H2,1H3,(H,12,16,18)/t5-,6?,7?,8+/m1/s1 |
| InChIKey | GKIZOFQVRUPRGW-CQRKAFIDSA-N |
| XLogP | -0.43 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|