About 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one
1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one (PubChem CID 88940948) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one.
Molecular Properties
| Compound Name | 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one |
| PubChem CID | 88940948 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one |
| SMILES | C=C(/C=C/C)C(=C)CNCC(C)=O |
| InChI | InChI=1S/C11H17NO/c1-5-6-9(2)10(3)7-12-8-11(4)13/h5-6,12H,2-3,7-8H2,1,4H3/b6-5+ |
| InChIKey | ZSWPKAOVZJCJHX-AATRIKPKSA-N |
| XLogP | 1.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one?
The IUPAC name of 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one (CID 88940948) is 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one.
What is the SMILES notation for 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one?
The canonical SMILES for 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one is C=C(/C=C/C)C(=C)CNCC(C)=O.
What is the InChIKey of 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one?
The InChIKey is ZSWPKAOVZJCJHX-AATRIKPKSA-N. The full InChI is InChI=1S/C11H17NO/c1-5-6-9(2)10(3)7-12-8-11(4)13/h5-6,12H,2-3,7-8H2,1,4H3/b6-5+.
What are the key properties of 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one?
1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one has a molecular weight of 179.26 g/mol, XLogP of 1.85, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(E)-2,3-dimethylidenehex-4-enyl]amino]propan-2-one is sourced from PubChem (CID 88940948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).