C17H14BrN5O — CID 8894103
4-[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1,2,4-triazole-3-carbonitrile (PubChem CID 8894103) has the molecular formula C17H14BrN5O and a molecular weight of 384.24 g/mol. Its IUPAC name is 4-[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1,2,4-triazole-3-carbonitrile.
| Compound Name | 4-[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 8894103 |
| Molecular Formula | C17H14BrN5O |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 4-[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1,2,4-triazole-3-carbonitrile |
| SMILES | Cc1cc(C(=O)Cn2cnnc2C#N)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H14BrN5O/c1-11-7-15(16(24)9-22-10-20-21-17(22)8-19)12(2)23(11)14-5-3-13(18)4-6-14/h3-7,10H,9H2,1-2H3 |
| InChIKey | KONHEMZVQRWVKV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|